C8H8F3N3OS — CID 103368878
3,3,3-trifluoro-2-[(2-oxopyrimidin-1-yl)methyl]propanethioamide (PubChem CID 103368878) has the molecular formula C8H8F3N3OS and a molecular weight of 251.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(2-oxopyrimidin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(2-oxopyrimidin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103368878 |
| Molecular Formula | C8H8F3N3OS |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3,3,3-trifluoro-2-[(2-oxopyrimidin-1-yl)methyl]propanethioamide |
| SMILES | NC(=S)C(Cn1cccnc1=O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3OS/c9-8(10,11)5(6(12)16)4-14-3-1-2-13-7(14)15/h1-3,5H,4H2,(H2,12,16) |
| InChIKey | FGHKRVXABKQBST-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|