C6H7F3N4S — CID 103368881
3,3,3-trifluoro-2-(1,2,4-triazol-1-ylmethyl)propanethioamide (PubChem CID 103368881) has the molecular formula C6H7F3N4S and a molecular weight of 224.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(1,2,4-triazol-1-ylmethyl)propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-(1,2,4-triazol-1-ylmethyl)propanethioamide |
|---|---|
| PubChem CID | 103368881 |
| Molecular Formula | C6H7F3N4S |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 3,3,3-trifluoro-2-(1,2,4-triazol-1-ylmethyl)propanethioamide |
| SMILES | NC(=S)C(Cn1cncn1)C(F)(F)F |
| InChI | InChI=1S/C6H7F3N4S/c7-6(8,9)4(5(10)14)1-13-3-11-2-12-13/h2-4H,1H2,(H2,10,14) |
| InChIKey | JPRURHIYDDSLPM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|