C10H12F3N3O2S — CID 103368938
2-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368938) has the molecular formula C10H12F3N3O2S and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368938 |
| Molecular Formula | C10H12F3N3O2S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-[(4,5-dimethyl-3,6-dioxo-1H-pyridazin-2-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | Cc1c(C)c(=O)n(CC(C(N)=S)C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H12F3N3O2S/c1-4-5(2)9(18)16(15-8(4)17)3-6(7(14)19)10(11,12)13/h6H,3H2,1-2H3,(H2,14,19)(H,15,17) |
| InChIKey | BMSPYDYRUNTCRK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|