C11H16F3N3O2S — CID 103368999
2-[(2,3-dioxo-4-propylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368999) has the molecular formula C11H16F3N3O2S and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-[(2,3-dioxo-4-propylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(2,3-dioxo-4-propylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368999 |
| Molecular Formula | C11H16F3N3O2S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(2,3-dioxo-4-propylpiperazin-1-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCCN1CCN(CC(C(N)=S)C(F)(F)F)C(=O)C1=O |
| InChI | InChI=1S/C11H16F3N3O2S/c1-2-3-16-4-5-17(10(19)9(16)18)6-7(8(15)20)11(12,13)14/h7H,2-6H2,1H3,(H2,15,20) |
| InChIKey | ZTIZPACMTBGXDI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|