C12H15F3N2O2S — CID 103369006
3,3,3-trifluoro-2-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]propanethioamide (PubChem CID 103369006) has the molecular formula C12H15F3N2O2S and a molecular weight of 308.33 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103369006 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 3,3,3-trifluoro-2-[(5-methyl-1,3-dioxo-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrol-2-yl)methyl]propanethioamide |
| SMILES | CC1CC2C(=O)N(CC(C(N)=S)C(F)(F)F)C(=O)C2C1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-5-2-6-7(3-5)11(19)17(10(6)18)4-8(9(16)20)12(13,14)15/h5-8H,2-4H2,1H3,(H2,16,20) |
| InChIKey | LJUPLFCOHFRVKL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|