C9H10F3N3O2S — CID 103369009
3,3,3-trifluoro-2-[(3-methoxy-6-oxopyridazin-1-yl)methyl]propanethioamide (PubChem CID 103369009) has the molecular formula C9H10F3N3O2S and a molecular weight of 281.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[(3-methoxy-6-oxopyridazin-1-yl)methyl]propanethioamide.
| Compound Name | 3,3,3-trifluoro-2-[(3-methoxy-6-oxopyridazin-1-yl)methyl]propanethioamide |
|---|---|
| PubChem CID | 103369009 |
| Molecular Formula | C9H10F3N3O2S |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 3,3,3-trifluoro-2-[(3-methoxy-6-oxopyridazin-1-yl)methyl]propanethioamide |
| SMILES | COc1ccc(=O)n(CC(C(N)=S)C(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F3N3O2S/c1-17-6-2-3-7(16)15(14-6)4-5(8(13)18)9(10,11)12/h2-3,5H,4H2,1H3,(H2,13,18) |
| InChIKey | DTAMOSAIKAWPTE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|