C12H20F3NOS — CID 103369046
2-[(2-ethylcyclohexyl)oxymethyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369046) has the molecular formula C12H20F3NOS and a molecular weight of 283.36 g/mol. Its IUPAC name is 2-[(2-ethylcyclohexyl)oxymethyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(2-ethylcyclohexyl)oxymethyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369046 |
| Molecular Formula | C12H20F3NOS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-[(2-ethylcyclohexyl)oxymethyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCC1CCCCC1OCC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C12H20F3NOS/c1-2-8-5-3-4-6-10(8)17-7-9(11(16)18)12(13,14)15/h8-10H,2-7H2,1H3,(H2,16,18) |
| InChIKey | LSNXBNOUBAYOBA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|