C14H17ClF3NOS — CID 103369114
2-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103369114) has the molecular formula C14H17ClF3NOS and a molecular weight of 339.81 g/mol. Its IUPAC name is 2-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369114 |
| Molecular Formula | C14H17ClF3NOS |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-[(4-chloro-2-methyl-5-propan-2-ylphenoxy)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | Cc1cc(Cl)c(C(C)C)cc1OCC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3NOS/c1-7(2)9-5-12(8(3)4-11(9)15)20-6-10(13(19)21)14(16,17)18/h4-5,7,10H,6H2,1-3H3,(H2,19,21) |
| InChIKey | OFIXIBOCUHAHAJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|