C6H8F5NOS — CID 103369179
2-(2,2-difluoroethoxymethyl)-3,3,3-trifluoropropanethioamide (PubChem CID 103369179) has the molecular formula C6H8F5NOS and a molecular weight of 237.19 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxymethyl)-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-(2,2-difluoroethoxymethyl)-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103369179 |
| Molecular Formula | C6H8F5NOS |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-(2,2-difluoroethoxymethyl)-3,3,3-trifluoropropanethioamide |
| SMILES | NC(=S)C(COCC(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H8F5NOS/c7-4(8)2-13-1-3(5(12)14)6(9,10)11/h3-4H,1-2H2,(H2,12,14) |
| InChIKey | PCZNXNITRAWVBB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|