C9H16F3N3O3S — CID 103369274
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369274) has the molecular formula C9H16F3N3O3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369274 |
| Molecular Formula | C9H16F3N3O3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CN(CC(C(N)=NO)C(F)(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16F3N3O3S/c1-15(6-2-3-19(17,18)5-6)4-7(8(13)14-16)9(10,11)12/h6-7,16H,2-5H2,1H3,(H2,13,14) |
| InChIKey | KEACAUBYCANHTK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|