C9H16F3N3OS — CID 103369301
3,3,3-trifluoro-N'-hydroxy-2-(1,4-thiazepan-4-ylmethyl)propanimidamide (PubChem CID 103369301) has the molecular formula C9H16F3N3OS and a molecular weight of 271.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-(1,4-thiazepan-4-ylmethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-(1,4-thiazepan-4-ylmethyl)propanimidamide |
|---|---|
| PubChem CID | 103369301 |
| Molecular Formula | C9H16F3N3OS |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-(1,4-thiazepan-4-ylmethyl)propanimidamide |
| SMILES | NC(=NO)C(CN1CCCSCC1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3OS/c10-9(11,12)7(8(13)14-16)6-15-2-1-4-17-5-3-15/h7,16H,1-6H2,(H2,13,14) |
| InChIKey | WSAQNSCOAGTKSH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|