About 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide
2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369369) has the molecular formula C13H22F3N3O
and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
Molecular Properties
| Compound Name | 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| PubChem CID | 103369369 |
| Molecular Formula | C13H22F3N3O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CN1CCCC1C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C13H22F3N3O/c14-13(15,16)10(12(17)18-20)8-19-7-3-6-11(19)9-4-1-2-5-9/h9-11,20H,1-8H2,(H2,17,18) |
| InChIKey | SMLKUYBQPZRHON-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The IUPAC name of 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (CID 103369369) is 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
What is the SMILES notation for 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The canonical SMILES for 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide is NC(=NO)C(CN1CCCC1C1CCCC1)C(F)(F)F.
What is the InChIKey of 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide?
The InChIKey is SMLKUYBQPZRHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F3N3O/c14-13(15,16)10(12(17)18-20)8-19-7-3-6-11(19)9-4-1-2-5-9/h9-11,20H,1-8H2,(H2,17,18).
What are the key properties of 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide?
2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide has a molecular weight of 293.33 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-cyclopentylpyrrolidin-1-yl)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide is sourced from PubChem (CID 103369369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).