C11H21F3N4O — CID 103369397
3,3,3-trifluoro-N'-hydroxy-2-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]propanimidamide (PubChem CID 103369397) has the molecular formula C11H21F3N4O and a molecular weight of 282.31 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369397 |
| Molecular Formula | C11H21F3N4O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[methyl-(1-methylpiperidin-3-yl)amino]methyl]propanimidamide |
| SMILES | CN1CCCC(N(C)CC(C(N)=NO)C(F)(F)F)C1 |
| InChI | InChI=1S/C11H21F3N4O/c1-17-5-3-4-8(6-17)18(2)7-9(10(15)16-19)11(12,13)14/h8-9,19H,3-7H2,1-2H3,(H2,15,16) |
| InChIKey | YOKCXUAYYYCZHN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|