C9H17F3N4O3S — CID 103369412
3,3,3-trifluoro-N'-hydroxy-2-[(4-methylsulfonylpiperazin-1-yl)methyl]propanimidamide (PubChem CID 103369412) has the molecular formula C9H17F3N4O3S and a molecular weight of 318.32 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(4-methylsulfonylpiperazin-1-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4-methylsulfonylpiperazin-1-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103369412 |
| Molecular Formula | C9H17F3N4O3S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4-methylsulfonylpiperazin-1-yl)methyl]propanimidamide |
| SMILES | CS(=O)(=O)N1CCN(CC(C(N)=NO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N4O3S/c1-20(18,19)16-4-2-15(3-5-16)6-7(8(13)14-17)9(10,11)12/h7,17H,2-6H2,1H3,(H2,13,14) |
| InChIKey | YBDDJPTYXBAVCB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|