C12H23F3N4O2 — CID 103369448
3,3,3-trifluoro-N'-hydroxy-2-[[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]methyl]propanimidamide (PubChem CID 103369448) has the molecular formula C12H23F3N4O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369448 |
| Molecular Formula | C12H23F3N4O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]methyl]propanimidamide |
| SMILES | CC(C)(O)CN1CCN(CC(C(N)=NO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H23F3N4O2/c1-11(2,20)8-19-5-3-18(4-6-19)7-9(10(16)17-21)12(13,14)15/h9,20-21H,3-8H2,1-2H3,(H2,16,17) |
| InChIKey | AIKDWRJQBIJZNY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|