C7H14F3N3O — CID 103369459
3,3,3-trifluoro-N'-hydroxy-2-[(propan-2-ylamino)methyl]propanimidamide (PubChem CID 103369459) has the molecular formula C7H14F3N3O and a molecular weight of 213.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(propan-2-ylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(propan-2-ylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103369459 |
| Molecular Formula | C7H14F3N3O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(propan-2-ylamino)methyl]propanimidamide |
| SMILES | CC(C)NCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O/c1-4(2)12-3-5(6(11)13-14)7(8,9)10/h4-5,12,14H,3H2,1-2H3,(H2,11,13) |
| InChIKey | IRKQNLNUTPZVCP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|