C12H16F3N3O3 — CID 103369521
2-[(3,5-dimethoxyanilino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369521) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-[(3,5-dimethoxyanilino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(3,5-dimethoxyanilino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369521 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[(3,5-dimethoxyanilino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | COc1cc(NCC(/C(N)=N/O)C(F)(F)F)cc(OC)c1 |
| InChI | InChI=1S/C12H16F3N3O3/c1-20-8-3-7(4-9(5-8)21-2)17-6-10(11(16)18-19)12(13,14)15/h3-5,10,17,19H,6H2,1-2H3,(H2,16,18) |
| InChIKey | ZNBPLBGTZGQGNS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|