About N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide
N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide (PubChem CID 10336953) has the molecular formula C17H13F3N2O2
and a molecular weight of 334.30 g/mol. Its IUPAC name is N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide |
| PubChem CID | 10336953 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide |
| SMILES | CCn1c(=O)c2ccc(NC(=O)C(F)(F)F)cc2c2ccccc21 |
| InChI | InChI=1S/C17H13F3N2O2/c1-2-22-14-6-4-3-5-11(14)13-9-10(7-8-12(13)15(22)23)21-16(24)17(18,19)20/h3-9H,2H2,1H3,(H,21,24) |
| InChIKey | GYNPNAAWMCWDSP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide (CID 10336953) is N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide is CCn1c(=O)c2ccc(NC(=O)C(F)(F)F)cc2c2ccccc21.
What is the InChIKey of N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide?
The InChIKey is GYNPNAAWMCWDSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O2/c1-2-22-14-6-4-3-5-11(14)13-9-10(7-8-12(13)15(22)23)21-16(24)17(18,19)20/h3-9H,2H2,1H3,(H,21,24).
What are the key properties of N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide?
N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide has a molecular weight of 334.30 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-6-oxophenanthridin-9-yl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 10336953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).