C6H11F3N4O2 — CID 103369567
2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide (PubChem CID 103369567) has the molecular formula C6H11F3N4O2 and a molecular weight of 228.17 g/mol. Its IUPAC name is 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide.
| Compound Name | 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
|---|---|
| PubChem CID | 103369567 |
| Molecular Formula | C6H11F3N4O2 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
| SMILES | NC(=O)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N4O2/c7-6(8,9)3(5(11)13-15)1-12-2-4(10)14/h3,12,15H,1-2H2,(H2,10,14)(H2,11,13) |
| InChIKey | SSWKEGFPQFMWCE-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|