C8H17F3N4O — CID 103369568
2-[[2-(dimethylamino)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369568) has the molecular formula C8H17F3N4O and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[2-(dimethylamino)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369568 |
| Molecular Formula | C8H17F3N4O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2-[[2-(dimethylamino)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CN(C)CCNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H17F3N4O/c1-15(2)4-3-13-5-6(7(12)14-16)8(9,10)11/h6,13,16H,3-5H2,1-2H3,(H2,12,14) |
| InChIKey | GMQWCDLWLSGJQZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|