C7H13F3N4O2 — CID 103369615
N-methyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide (PubChem CID 103369615) has the molecular formula C7H13F3N4O2 and a molecular weight of 242.20 g/mol. Its IUPAC name is N-methyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide.
| Compound Name | N-methyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
|---|---|
| PubChem CID | 103369615 |
| Molecular Formula | C7H13F3N4O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | N-methyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
| SMILES | CNC(=O)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N4O2/c1-12-5(15)3-13-2-4(6(11)14-16)7(8,9)10/h4,13,16H,2-3H2,1H3,(H2,11,14)(H,12,15) |
| InChIKey | CHRWNIOQVBWVBW-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|