C9H17F3N4O2 — CID 103369644
N-propyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide (PubChem CID 103369644) has the molecular formula C9H17F3N4O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is N-propyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide.
| Compound Name | N-propyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
|---|---|
| PubChem CID | 103369644 |
| Molecular Formula | C9H17F3N4O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-propyl-2-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]acetamide |
| SMILES | CCCNC(=O)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N4O2/c1-2-3-15-7(17)5-14-4-6(8(13)16-18)9(10,11)12/h6,14,18H,2-5H2,1H3,(H2,13,16)(H,15,17) |
| InChIKey | AIHJTQUYHZPVCH-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|