C9H16F3N3O3S — CID 103369755
2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369755) has the molecular formula C9H16F3N3O3S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369755 |
| Molecular Formula | C9H16F3N3O3S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CNCC1CCS(=O)(=O)C1)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O3S/c10-9(11,12)7(8(13)15-16)4-14-3-6-1-2-19(17,18)5-6/h6-7,14,16H,1-5H2,(H2,13,15) |
| InChIKey | XMPUHZAFAOHKMK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|