C12H16F3N3OS — CID 103369758
2-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369758) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 2-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369758 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CNCc1cc2c(s1)CCC2)C(F)(F)F |
| InChI | InChI=1S/C12H16F3N3OS/c13-12(14,15)9(11(16)18-19)6-17-5-8-4-7-2-1-3-10(7)20-8/h4,9,17,19H,1-3,5-6H2,(H2,16,18) |
| InChIKey | MLDBWLMDRYHAHZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|