C12H18F3N3OS — CID 103369808
3,3,3-trifluoro-N'-hydroxy-2-[[(2-methyl-1-thiophen-2-ylpropyl)amino]methyl]propanimidamide (PubChem CID 103369808) has the molecular formula C12H18F3N3OS and a molecular weight of 309.36 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(2-methyl-1-thiophen-2-ylpropyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(2-methyl-1-thiophen-2-ylpropyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369808 |
| Molecular Formula | C12H18F3N3OS |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(2-methyl-1-thiophen-2-ylpropyl)amino]methyl]propanimidamide |
| SMILES | CC(C)C(NCC(/C(N)=N/O)C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C12H18F3N3OS/c1-7(2)10(9-4-3-5-20-9)17-6-8(11(16)18-19)12(13,14)15/h3-5,7-8,10,17,19H,6H2,1-2H3,(H2,16,18) |
| InChIKey | PGFXGHSAQWNXSF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|