C13H24F3N3O — CID 103369826
3,3,3-trifluoro-N'-hydroxy-2-[[(4-propylcyclohexyl)amino]methyl]propanimidamide (PubChem CID 103369826) has the molecular formula C13H24F3N3O and a molecular weight of 295.35 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(4-propylcyclohexyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(4-propylcyclohexyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369826 |
| Molecular Formula | C13H24F3N3O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(4-propylcyclohexyl)amino]methyl]propanimidamide |
| SMILES | CCCC1CCC(NCC(C(N)=NO)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H24F3N3O/c1-2-3-9-4-6-10(7-5-9)18-8-11(12(17)19-20)13(14,15)16/h9-11,18,20H,2-8H2,1H3,(H2,17,19) |
| InChIKey | TVVMTYSRZKNCCR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|