C12H18F3N3O2 — CID 103369836
2-[[1-(2,5-dimethylfuran-3-yl)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369836) has the molecular formula C12H18F3N3O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-[[1-(2,5-dimethylfuran-3-yl)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[1-(2,5-dimethylfuran-3-yl)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369836 |
| Molecular Formula | C12H18F3N3O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[[1-(2,5-dimethylfuran-3-yl)ethylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | Cc1cc(C(C)NCC(/C(N)=N/O)C(F)(F)F)c(C)o1 |
| InChI | InChI=1S/C12H18F3N3O2/c1-6-4-9(8(3)20-6)7(2)17-5-10(11(16)18-19)12(13,14)15/h4,7,10,17,19H,5H2,1-3H3,(H2,16,18) |
| InChIKey | OMYOVXLPCHPKNY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|