C7H14F3N3O3 — CID 103369913
2-[(1,3-dihydroxypropan-2-ylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369913) has the molecular formula C7H14F3N3O3 and a molecular weight of 245.20 g/mol. Its IUPAC name is 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369913 |
| Molecular Formula | C7H14F3N3O3 |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 2-[(1,3-dihydroxypropan-2-ylamino)methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | NC(=NO)C(CNC(CO)CO)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O3/c8-7(9,10)5(6(11)13-16)1-12-4(2-14)3-15/h4-5,12,14-16H,1-3H2,(H2,11,13) |
| InChIKey | UEJTXNPXKSWXNB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|