C10H15F3N4O3 — CID 103369940
3,3,3-trifluoro-N'-hydroxy-2-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]propanimidamide (PubChem CID 103369940) has the molecular formula C10H15F3N4O3 and a molecular weight of 296.25 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369940 |
| Molecular Formula | C10H15F3N4O3 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(1-methyl-2,6-dioxopiperidin-3-yl)amino]methyl]propanimidamide |
| SMILES | CN1C(=O)CCC(NCC(C(N)=NO)C(F)(F)F)C1=O |
| InChI | InChI=1S/C10H15F3N4O3/c1-17-7(18)3-2-6(9(17)19)15-4-5(8(14)16-20)10(11,12)13/h5-6,15,20H,2-4H2,1H3,(H2,14,16) |
| InChIKey | ZHJURZQTWLEQRY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|