C8H14F3N3O2 — CID 103369942
3,3,3-trifluoro-N'-hydroxy-2-[[(3-hydroxycyclobutyl)amino]methyl]propanimidamide (PubChem CID 103369942) has the molecular formula C8H14F3N3O2 and a molecular weight of 241.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(3-hydroxycyclobutyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(3-hydroxycyclobutyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103369942 |
| Molecular Formula | C8H14F3N3O2 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(3-hydroxycyclobutyl)amino]methyl]propanimidamide |
| SMILES | NC(=NO)C(CNC1CC(O)C1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3N3O2/c9-8(10,11)6(7(12)14-16)3-13-4-1-5(15)2-4/h4-6,13,15-16H,1-3H2,(H2,12,14) |
| InChIKey | NDGCIUXYERFZMT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|