C8H16F3N3O3 — CID 103369947
2-[[(2,3-dihydroxy-2-methylpropyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103369947) has the molecular formula C8H16F3N3O3 and a molecular weight of 259.23 g/mol. Its IUPAC name is 2-[[(2,3-dihydroxy-2-methylpropyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(2,3-dihydroxy-2-methylpropyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103369947 |
| Molecular Formula | C8H16F3N3O3 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[[(2,3-dihydroxy-2-methylpropyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CC(O)(CO)CNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O3/c1-7(16,4-15)3-13-2-5(6(12)14-17)8(9,10)11/h5,13,15-17H,2-4H2,1H3,(H2,12,14) |
| InChIKey | IHKRTHDQDUSZJO-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|