C8H13F6N3O — CID 103370082
3,3,3-trifluoro-N'-hydroxy-2-[(4,4,4-trifluorobutylamino)methyl]propanimidamide (PubChem CID 103370082) has the molecular formula C8H13F6N3O and a molecular weight of 281.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(4,4,4-trifluorobutylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4,4,4-trifluorobutylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370082 |
| Molecular Formula | C8H13F6N3O |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4,4,4-trifluorobutylamino)methyl]propanimidamide |
| SMILES | NC(=NO)C(CNCCCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6N3O/c9-7(10,11)2-1-3-16-4-5(6(15)17-18)8(12,13)14/h5,16,18H,1-4H2,(H2,15,17) |
| InChIKey | MZEQDQROUWMSJS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|