C11H20F3N3O2 — CID 103370102
2-[[(2,2-dimethyloxan-4-yl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370102) has the molecular formula C11H20F3N3O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-[[(2,2-dimethyloxan-4-yl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(2,2-dimethyloxan-4-yl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370102 |
| Molecular Formula | C11H20F3N3O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[[(2,2-dimethyloxan-4-yl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CC1(C)CC(NCC(C(N)=NO)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C11H20F3N3O2/c1-10(2)5-7(3-4-19-10)16-6-8(9(15)17-18)11(12,13)14/h7-8,16,18H,3-6H2,1-2H3,(H2,15,17) |
| InChIKey | PRYVKHNTCUZYEM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|