C12H23F3N4O — CID 103370107
2-[[[1-(dimethylamino)cyclopentyl]methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370107) has the molecular formula C12H23F3N4O and a molecular weight of 296.34 g/mol. Its IUPAC name is 2-[[[1-(dimethylamino)cyclopentyl]methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[[1-(dimethylamino)cyclopentyl]methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370107 |
| Molecular Formula | C12H23F3N4O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[[[1-(dimethylamino)cyclopentyl]methylamino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CN(C)C1(CNCC(C(N)=NO)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C12H23F3N4O/c1-19(2)11(5-3-4-6-11)8-17-7-9(10(16)18-20)12(13,14)15/h9,17,20H,3-8H2,1-2H3,(H2,16,18) |
| InChIKey | SLKPLZNRWSMXCW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|