C14H26F3N3O — CID 103370117
3,3,3-trifluoro-N'-hydroxy-2-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]propanimidamide (PubChem CID 103370117) has the molecular formula C14H26F3N3O and a molecular weight of 309.38 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370117 |
| Molecular Formula | C14H26F3N3O |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(3,3,5,5-tetramethylcyclohexyl)amino]methyl]propanimidamide |
| SMILES | CC1(C)CC(NCC(C(N)=NO)C(F)(F)F)CC(C)(C)C1 |
| InChI | InChI=1S/C14H26F3N3O/c1-12(2)5-9(6-13(3,4)8-12)19-7-10(11(18)20-21)14(15,16)17/h9-10,19,21H,5-8H2,1-4H3,(H2,18,20) |
| InChIKey | UFFMJMLLQIOFNF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|