C11H18F3N3O2 — CID 103370124
3,3,3-trifluoro-N'-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]propanimidamide (PubChem CID 103370124) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]propanimidamide |
|---|---|
| PubChem CID | 103370124 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)methyl]propanimidamide |
| SMILES | NC(=NO)C(CN1CC2CCC(O)C2C1)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O2/c12-11(13,14)8(10(15)16-19)5-17-3-6-1-2-9(18)7(6)4-17/h6-9,18-19H,1-5H2,(H2,15,16) |
| InChIKey | SHBJNVZYUOETSO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|