C11H21F3N4O2 — CID 103370142
N-(2-methylpropyl)-3-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]propanamide (PubChem CID 103370142) has the molecular formula C11H21F3N4O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is N-(2-methylpropyl)-3-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]propanamide.
| Compound Name | N-(2-methylpropyl)-3-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]propanamide |
|---|---|
| PubChem CID | 103370142 |
| Molecular Formula | C11H21F3N4O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-(2-methylpropyl)-3-[[3,3,3-trifluoro-2-(N'-hydroxycarbamimidoyl)propyl]amino]propanamide |
| SMILES | CC(C)CNC(=O)CCNCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N4O2/c1-7(2)5-17-9(19)3-4-16-6-8(10(15)18-20)11(12,13)14/h7-8,16,20H,3-6H2,1-2H3,(H2,15,18)(H,17,19) |
| InChIKey | DVVITLHSFUUQTL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|