C10H18F3N3O — CID 103370191
2-[[(1-ethylcyclobutyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370191) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 2-[[(1-ethylcyclobutyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[[(1-ethylcyclobutyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370191 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[[(1-ethylcyclobutyl)amino]methyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCC1(NCC(C(N)=NO)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C10H18F3N3O/c1-2-9(4-3-5-9)15-6-7(8(14)16-17)10(11,12)13/h7,15,17H,2-6H2,1H3,(H2,14,16) |
| InChIKey | NILAERAQDPMUOF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|