C9H18F3N3O2 — CID 103370206
3,3,3-trifluoro-N'-hydroxy-2-[[(4-hydroxy-2-methylbutan-2-yl)amino]methyl]propanimidamide (PubChem CID 103370206) has the molecular formula C9H18F3N3O2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[[(4-hydroxy-2-methylbutan-2-yl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(4-hydroxy-2-methylbutan-2-yl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370206 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[[(4-hydroxy-2-methylbutan-2-yl)amino]methyl]propanimidamide |
| SMILES | CC(C)(CCO)NCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O2/c1-8(2,3-4-16)14-5-6(7(13)15-17)9(10,11)12/h6,14,16-17H,3-5H2,1-2H3,(H2,13,15) |
| InChIKey | WLYWIVZQGBLKAO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|