C8H15F3N2O2 — CID 103370414
2-(butan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370414) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 2-(butan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-(butan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370414 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-(butan-2-yloxymethyl)-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CCC(C)OCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-3-5(2)15-4-6(7(12)13-14)8(9,10)11/h5-6,14H,3-4H2,1-2H3,(H2,12,13) |
| InChIKey | NXHBYYDBGHRNKY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|