C11H19F3N2O3 — CID 103370503
2-[(2,6-dimethyloxan-4-yl)oxymethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide (PubChem CID 103370503) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 103370503 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[(2,6-dimethyloxan-4-yl)oxymethyl]-3,3,3-trifluoro-N'-hydroxypropanimidamide |
| SMILES | CC1CC(OCC(C(N)=NO)C(F)(F)F)CC(C)O1 |
| InChI | InChI=1S/C11H19F3N2O3/c1-6-3-8(4-7(2)19-6)18-5-9(10(15)16-17)11(12,13)14/h6-9,17H,3-5H2,1-2H3,(H2,15,16) |
| InChIKey | HVPCQMOEFDHLCM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|