C11H21F3N2O5 — CID 103370505
3,3,3-trifluoro-N'-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]propanimidamide (PubChem CID 103370505) has the molecular formula C11H21F3N2O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]propanimidamide |
|---|---|
| PubChem CID | 103370505 |
| Molecular Formula | C11H21F3N2O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxymethyl]propanimidamide |
| SMILES | COCCOCCOCCOCC(C(N)=NO)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O5/c1-18-2-3-19-4-5-20-6-7-21-8-9(10(15)16-17)11(12,13)14/h9,17H,2-8H2,1H3,(H2,15,16) |
| InChIKey | ICFGWIUPETUORB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|