C10H19F3N4O — CID 103370591
3,3,3-trifluoro-2-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]propanimidamide (PubChem CID 103370591) has the molecular formula C10H19F3N4O and a molecular weight of 268.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370591 |
| Molecular Formula | C10H19F3N4O |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 3,3,3-trifluoro-2-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCN(CCO)CC1)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N4O/c11-10(12,13)8(9(14)15)7-17-3-1-16(2-4-17)5-6-18/h8,18H,1-7H2,(H3,14,15) |
| InChIKey | YJEBCFKDYPENAY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|