C7H14F3N3O — CID 103370599
3,3,3-trifluoro-2-[[2-hydroxyethyl(methyl)amino]methyl]propanimidamide (PubChem CID 103370599) has the molecular formula C7H14F3N3O and a molecular weight of 213.20 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[2-hydroxyethyl(methyl)amino]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[2-hydroxyethyl(methyl)amino]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370599 |
| Molecular Formula | C7H14F3N3O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[[2-hydroxyethyl(methyl)amino]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN(C)CCO)C(F)(F)F |
| InChI | InChI=1S/C7H14F3N3O/c1-13(2-3-14)4-5(6(11)12)7(8,9)10/h5,14H,2-4H2,1H3,(H3,11,12) |
| InChIKey | SLKYAASCXRANSQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|