C10H18F3N3 — CID 103370737
2-[(2,2-dimethylpyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370737) has the molecular formula C10H18F3N3 and a molecular weight of 237.27 g/mol. Its IUPAC name is 2-[(2,2-dimethylpyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(2,2-dimethylpyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370737 |
| Molecular Formula | C10H18F3N3 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-[(2,2-dimethylpyrrolidin-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCCC1(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3/c1-9(2)4-3-5-16(9)6-7(8(14)15)10(11,12)13/h7H,3-6H2,1-2H3,(H3,14,15) |
| InChIKey | KTWBAVVVPGNPHY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|