C9H16F3N3O2 — CID 103370834
3,3,3-trifluoro-2-[[3-(hydroxymethyl)morpholin-4-yl]methyl]propanimidamide (PubChem CID 103370834) has the molecular formula C9H16F3N3O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[[3-(hydroxymethyl)morpholin-4-yl]methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-[[3-(hydroxymethyl)morpholin-4-yl]methyl]propanimidamide |
|---|---|
| PubChem CID | 103370834 |
| Molecular Formula | C9H16F3N3O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3,3,3-trifluoro-2-[[3-(hydroxymethyl)morpholin-4-yl]methyl]propanimidamide |
| SMILES | [H]/N=C(\N)C(CN1CCOCC1CO)C(F)(F)F |
| InChI | InChI=1S/C9H16F3N3O2/c10-9(11,12)7(8(13)14)3-15-1-2-17-5-6(15)4-16/h6-7,16H,1-5H2,(H3,13,14) |
| InChIKey | MBZSDDKBVQANEN-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|