C13H15F3N4 — CID 103370856
2-[(5,6-dimethylbenzimidazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370856) has the molecular formula C13H15F3N4 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[(5,6-dimethylbenzimidazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(5,6-dimethylbenzimidazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370856 |
| Molecular Formula | C13H15F3N4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(5,6-dimethylbenzimidazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(Cn1cnc2cc(C)c(C)cc21)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4/c1-7-3-10-11(4-8(7)2)20(6-19-10)5-9(12(17)18)13(14,15)16/h3-4,6,9H,5H2,1-2H3,(H3,17,18) |
| InChIKey | UYVQCOWOAWFYRM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|