C9H12ClF3N4 — CID 103370873
2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370873) has the molecular formula C9H12ClF3N4 and a molecular weight of 268.67 g/mol. Its IUPAC name is 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370873 |
| Molecular Formula | C9H12ClF3N4 |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(Cn1nc(C)c(Cl)c1C)C(F)(F)F |
| InChI | InChI=1S/C9H12ClF3N4/c1-4-7(10)5(2)17(16-4)3-6(8(14)15)9(11,12)13/h6H,3H2,1-2H3,(H3,14,15) |
| InChIKey | NVVSGRXTKRIQBJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|