C12H14ClF3N2O — CID 103370941
2-[(4-chloro-2,6-dimethylphenoxy)methyl]-3,3,3-trifluoropropanimidamide (PubChem CID 103370941) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-3,3,3-trifluoropropanimidamide.
| Compound Name | 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-3,3,3-trifluoropropanimidamide |
|---|---|
| PubChem CID | 103370941 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[(4-chloro-2,6-dimethylphenoxy)methyl]-3,3,3-trifluoropropanimidamide |
| SMILES | [H]/N=C(\N)C(COc1c(C)cc(Cl)cc1C)C(F)(F)F |
| InChI | InChI=1S/C12H14ClF3N2O/c1-6-3-8(13)4-7(2)10(6)19-5-9(11(17)18)12(14,15)16/h3-4,9H,5H2,1-2H3,(H3,17,18) |
| InChIKey | QOYALDCQDKSSRY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|