C8H15F3N2O2 — CID 103371059
3,3,3-trifluoro-2-(1-methoxypropan-2-yloxymethyl)propanimidamide (PubChem CID 103371059) has the molecular formula C8H15F3N2O2 and a molecular weight of 228.21 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-(1-methoxypropan-2-yloxymethyl)propanimidamide.
| Compound Name | 3,3,3-trifluoro-2-(1-methoxypropan-2-yloxymethyl)propanimidamide |
|---|---|
| PubChem CID | 103371059 |
| Molecular Formula | C8H15F3N2O2 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 3,3,3-trifluoro-2-(1-methoxypropan-2-yloxymethyl)propanimidamide |
| SMILES | [H]/N=C(\N)C(COC(C)COC)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O2/c1-5(3-14-2)15-4-6(7(12)13)8(9,10)11/h5-6H,3-4H2,1-2H3,(H3,12,13) |
| InChIKey | BAISBMAYQNWFEX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|